C9H8N4O — CID 137219520
1,3,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-one (PubChem CID 137219520) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 1,3,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-one.
| Compound Name | 1,3,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-one |
|---|---|
| PubChem CID | 137219520 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 1,3,8,10-tetrazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-11-one |
| SMILES | O=C1CCn2c(nc3cccnc32)N1 |
| InChI | InChI=1S/C9H8N4O/c14-7-3-5-13-8-6(2-1-4-10-8)11-9(13)12-7/h1-2,4H,3,5H2,(H,11,12,14) |
| InChIKey | BWWNDXIXKWWSCS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |