C15H17BrN4O2 — CID 135433984
3-(5-bromo-6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1,1-diethylurea (PubChem CID 135433984) has the molecular formula C15H17BrN4O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is 3-(5-bromo-6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1,1-diethylurea.
| Compound Name | 3-(5-bromo-6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1,1-diethylurea |
|---|---|
| PubChem CID | 135433984 |
| Molecular Formula | C15H17BrN4O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 3-(5-bromo-6-oxo-4-phenyl-1H-pyrimidin-2-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1nc(-c2ccccc2)c(Br)c(=O)[nH]1 |
| InChI | InChI=1S/C15H17BrN4O2/c1-3-20(4-2)15(22)19-14-17-12(11(16)13(21)18-14)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H2,17,18,19,21,22) |
| InChIKey | MTUWPKCNYCVOMI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |