C12H10N2O5 — CID 135434362
5-hydroxy-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 135434362) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 5-hydroxy-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 5-hydroxy-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135434362 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-hydroxy-2-(3-methoxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | COc1cccc(-c2nc(C(=O)O)c(O)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C12H10N2O5/c1-19-7-4-2-3-6(5-7)10-13-8(12(17)18)9(15)11(16)14-10/h2-5,15H,1H3,(H,17,18)(H,13,14,16) |
| InChIKey | STRWJVMVKMROHR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |