C11H8N2O5 — CID 135434259
5-hydroxy-2-(2-hydroxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid (PubChem CID 135434259) has the molecular formula C11H8N2O5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 5-hydroxy-2-(2-hydroxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid.
| Compound Name | 5-hydroxy-2-(2-hydroxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 135434259 |
| Molecular Formula | C11H8N2O5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-hydroxy-2-(2-hydroxyphenyl)-6-oxo-1H-pyrimidine-4-carboxylic acid |
| SMILES | O=C(O)c1nc(-c2ccccc2O)[nH]c(=O)c1O |
| InChI | InChI=1S/C11H8N2O5/c14-6-4-2-1-3-5(6)9-12-7(11(17)18)8(15)10(16)13-9/h1-4,14-15H,(H,17,18)(H,12,13,16) |
| InChIKey | MGEOVRBBUGDAMP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |