C16H12N2O2 — CID 135803995
4-(2-hydroxyphenyl)-2-phenyl-1H-pyrimidin-6-one (PubChem CID 135803995) has the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-2-phenyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2-hydroxyphenyl)-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135803995 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 4-(2-hydroxyphenyl)-2-phenyl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2ccccc2O)nc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C16H12N2O2/c19-14-9-5-4-8-12(14)13-10-15(20)18-16(17-13)11-6-2-1-3-7-11/h1-10,19H,(H,17,18,20) |
| InChIKey | LLJKDEMSSVSYRN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |