C20H20N2O2 — CID 135422953
2-(2-hydroxyphenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one (PubChem CID 135422953) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one.
| Compound Name | 2-(2-hydroxyphenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 135422953 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(2-hydroxyphenyl)-5,6-dimethyl-3-(2-phenylethyl)pyrimidin-4-one |
| SMILES | Cc1nc(-c2ccccc2O)n(CCc2ccccc2)c(=O)c1C |
| InChI | InChI=1S/C20H20N2O2/c1-14-15(2)21-19(17-10-6-7-11-18(17)23)22(20(14)24)13-12-16-8-4-3-5-9-16/h3-11,23H,12-13H2,1-2H3 |
| InChIKey | BXGMPNJZRYPCBV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |