C16H17F2N3O — CID 135434834
4-[(2,6-difluorophenyl)methyl]-2-piperidin-1-yl-1H-pyrimidin-6-one (PubChem CID 135434834) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methyl]-2-piperidin-1-yl-1H-pyrimidin-6-one.
| Compound Name | 4-[(2,6-difluorophenyl)methyl]-2-piperidin-1-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135434834 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methyl]-2-piperidin-1-yl-1H-pyrimidin-6-one |
| SMILES | O=c1cc(Cc2c(F)cccc2F)nc(N2CCCCC2)[nH]1 |
| InChI | InChI=1S/C16H17F2N3O/c17-13-5-4-6-14(18)12(13)9-11-10-15(22)20-16(19-11)21-7-2-1-3-8-21/h4-6,10H,1-3,7-9H2,(H,19,20,22) |
| InChIKey | SOASNPRPIZLAMB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |