C20H20N6O4 — CID 135436209
ethyl 2-[6-[(3,7-dimethyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)amino]benzotriazol-1-yl]acetate (PubChem CID 135436209) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is ethyl 2-[6-[(3,7-dimethyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)amino]benzotriazol-1-yl]acetate.
| Compound Name | ethyl 2-[6-[(3,7-dimethyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)amino]benzotriazol-1-yl]acetate |
|---|---|
| PubChem CID | 135436209 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | ethyl 2-[6-[(3,7-dimethyl-1,4-dioxidoquinoxaline-1,4-diium-2-yl)amino]benzotriazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nnc2ccc(Nc3c(C)[n+]([O-])c4ccc(C)cc4[n+]3[O-])cc21 |
| InChI | InChI=1S/C20H20N6O4/c1-4-30-19(27)11-24-17-10-14(6-7-15(17)22-23-24)21-20-13(3)25(28)16-8-5-12(2)9-18(16)26(20)29/h5-10,21H,4,11H2,1-3H3 |
| InChIKey | WPOUTJXXYMBGBK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 122.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|