C14H22N4O2 — CID 135436333
2,4-bis[(Z)-(dimethylhydrazinylidene)methyl]-6-ethoxyphenol (PubChem CID 135436333) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2,4-bis[(Z)-(dimethylhydrazinylidene)methyl]-6-ethoxyphenol.
| Compound Name | 2,4-bis[(Z)-(dimethylhydrazinylidene)methyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 135436333 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2,4-bis[(Z)-(dimethylhydrazinylidene)methyl]-6-ethoxyphenol |
| SMILES | CCOc1cc(/C=N\N(C)C)cc(/C=N\N(C)C)c1O |
| InChI | InChI=1S/C14H22N4O2/c1-6-20-13-8-11(9-15-17(2)3)7-12(14(13)19)10-16-18(4)5/h7-10,19H,6H2,1-5H3/b15-9-,16-10- |
| InChIKey | MSFGDZDRGSLLKR-VULZFCBJSA-N |
| XLogP | 1.58 |
| TPSA | 60.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|