C20H16CuN4O8 — CID 135436493
bis((NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine);copper (PubChem CID 135436493) has the molecular formula C20H16CuN4O8 and a molecular weight of 503.91 g/mol. Its IUPAC name is bis((NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine);copper.
| Compound Name | bis((NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine);copper |
|---|---|
| PubChem CID | 135436493 |
| Molecular Formula | C20H16CuN4O8 |
| Molecular Weight | 503.91 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | bis((NZ)-N-[(2Z)-1,2-bis(furan-2-yl)-2-hydroxyiminoethylidene]hydroxylamine);copper |
| SMILES | O/N=C(C(=N/O)/c1ccco1)\c1ccco1.O/N=C(C(=N/O)/c1ccco1)\c1ccco1.[Cu] |
| InChI | InChI=1S/2C10H8N2O4.Cu/c2*13-11-9(7-3-1-5-15-7)10(12-14)8-4-2-6-16-8;/h2*1-6,13-14H;/b2*11-9+,12-10+; |
| InChIKey | VGBHIULFTBXBGQ-ZLNBHMKHSA-N |
| XLogP | 3.86 |
| TPSA | 182.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.91 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|