About (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone
(2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone (PubChem CID 6401304) has the molecular formula C10H7NO4
and a molecular weight of 205.17 g/mol. Its IUPAC name is (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone.
Molecular Properties
| Compound Name | (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone |
| PubChem CID | 6401304 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone |
| SMILES | O=C(/C(=N/O)c1ccco1)c1ccco1 |
| InChI | InChI=1S/C10H7NO4/c12-10(8-4-2-6-15-8)9(11-13)7-3-1-5-14-7/h1-6,13H/b11-9+ |
| InChIKey | RSLKNHHWFJLREX-PKNBQFBNSA-N |
| XLogP | 1.93 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone?
The IUPAC name of (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone (CID 6401304) is (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone.
What is the SMILES notation for (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone?
The canonical SMILES for (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone is O=C(/C(=N/O)c1ccco1)c1ccco1.
What is the InChIKey of (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone?
The InChIKey is RSLKNHHWFJLREX-PKNBQFBNSA-N. The full InChI is InChI=1S/C10H7NO4/c12-10(8-4-2-6-15-8)9(11-13)7-3-1-5-14-7/h1-6,13H/b11-9+.
What are the key properties of (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone?
(2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone has a molecular weight of 205.17 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-1,2-bis(furan-2-yl)-2-hydroxyiminoethanone is sourced from PubChem (CID 6401304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).