C11H15N3OS — CID 135438137
3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-1,1-dimethylthiourea (PubChem CID 135438137) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-1,1-dimethylthiourea.
| Compound Name | 3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 135438137 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-1,1-dimethylthiourea |
| SMILES | C/C(=N\NC(=S)N(C)C)c1ccccc1O |
| InChI | InChI=1S/C11H15N3OS/c1-8(12-13-11(16)14(2)3)9-6-4-5-7-10(9)15/h4-7,15H,1-3H3,(H,13,16)/b12-8+ |
| InChIKey | HZBQABOWXXTKMC-XYOKQWHBSA-N |
| XLogP | 1.55 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|