C9H11N3OS — CID 135533447
1-[(E)-(2-hydroxyphenyl)methylideneamino]-3-methylthiourea (PubChem CID 135533447) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 1-[(E)-(2-hydroxyphenyl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-(2-hydroxyphenyl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 135533447 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 1-[(E)-(2-hydroxyphenyl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C9H11N3OS/c1-10-9(14)12-11-6-7-4-2-3-5-8(7)13/h2-6,13H,1H3,(H2,10,12,14)/b11-6+ |
| InChIKey | UFQANJFFCZGQCI-IZZDOVSWSA-N |
| XLogP | 0.82 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|