C9H7N3OS2 — CID 135688242
5-[(E)-(2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 135688242) has the molecular formula C9H7N3OS2 and a molecular weight of 237.31 g/mol. Its IUPAC name is 5-[(E)-(2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(E)-(2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 135688242 |
| Molecular Formula | C9H7N3OS2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 5-[(E)-(2-hydroxyphenyl)methylideneamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | Oc1ccccc1/C=N/c1n[nH]c(=S)s1 |
| InChI | InChI=1S/C9H7N3OS2/c13-7-4-2-1-3-6(7)5-10-8-11-12-9(14)15-8/h1-5,13H,(H,12,14)/b10-5+ |
| InChIKey | IALAVJLXFRTJRB-BJMVGYQFSA-N |
| XLogP | 2.66 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|