C8H9N3O2S — CID 135455078
[(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea (PubChem CID 135455078) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is [(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea.
| Compound Name | [(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 135455078 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | [(E)-(2,3-dihydroxyphenyl)methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1cccc(O)c1O |
| InChI | InChI=1S/C8H9N3O2S/c9-8(14)11-10-4-5-2-1-3-6(12)7(5)13/h1-4,12-13H,(H3,9,11,14)/b10-4+ |
| InChIKey | BBAULBCUTURIMD-ONNFQVAWSA-N |
| XLogP | 0.26 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|