C34H35N7O3 — CID 135441227
2-ethyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide (PubChem CID 135441227) has the molecular formula C34H35N7O3 and a molecular weight of 589.70 g/mol. Its IUPAC name is 2-ethyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135441227 |
| Molecular Formula | C34H35N7O3 |
| Molecular Weight | 589.70 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 2-ethyl-N-[4-[2-hydroxy-3-[[4-(4-methylpiperazin-1-yl)phenyl]iminomethyl]-1H-indole-6-carbonyl]phenyl]-5-methylpyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1ccc(C(=O)c2ccc3c(/C=N/c4ccc(N5CCN(C)CC5)cc4)c(O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C34H35N7O3/c1-4-41-31(19-22(2)38-41)34(44)36-26-8-5-23(6-9-26)32(42)24-7-14-28-29(33(43)37-30(28)20-24)21-35-25-10-12-27(13-11-25)40-17-15-39(3)16-18-40/h5-14,19-21,37,43H,4,15-18H2,1-3H3,(H,36,44)/b35-21+ |
| InChIKey | RCMPKBFMAJGEPR-XICOUIIWSA-N |
| XLogP | 5.38 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|