C11H11N5O5S2 — CID 135441660
N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-nitrobenzenesulfonamide (PubChem CID 135441660) has the molecular formula C11H11N5O5S2 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-nitrobenzenesulfonamide.
| Compound Name | N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135441660 |
| Molecular Formula | C11H11N5O5S2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-nitrobenzenesulfonamide |
| SMILES | CSc1nc(N)c(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H11N5O5S2/c1-22-11-13-9(12)8(10(17)14-11)15-23(20,21)7-4-2-6(3-5-7)16(18)19/h2-5,15H,1H3,(H3,12,13,14,17) |
| InChIKey | XLGSMERUQSZFMX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 161.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|