C19H18N2O5S — CID 135442499
2-[1-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)ethylideneamino]benzenesulfonic acid (PubChem CID 135442499) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is 2-[1-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)ethylideneamino]benzenesulfonic acid.
| Compound Name | 2-[1-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)ethylideneamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 135442499 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[1-(1-ethyl-4-hydroxy-2-oxoquinolin-3-yl)ethylideneamino]benzenesulfonic acid |
| SMILES | CCn1c(=O)c(/C(C)=N/c2ccccc2S(=O)(=O)O)c(O)c2ccccc21 |
| InChI | InChI=1S/C19H18N2O5S/c1-3-21-15-10-6-4-8-13(15)18(22)17(19(21)23)12(2)20-14-9-5-7-11-16(14)27(24,25)26/h4-11,22H,3H2,1-2H3,(H,24,25,26)/b20-12+ |
| InChIKey | NOJHCINFNLDBSP-UDWIEESQSA-N |
| XLogP | 3.11 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|