C23H17N3O4 — CID 135525034
4-hydroxy-3-[C-methyl-N-(2-nitrophenyl)carbonimidoyl]-1-phenylquinolin-2-one (PubChem CID 135525034) has the molecular formula C23H17N3O4 and a molecular weight of 399.41 g/mol. Its IUPAC name is 4-hydroxy-3-[C-methyl-N-(2-nitrophenyl)carbonimidoyl]-1-phenylquinolin-2-one.
| Compound Name | 4-hydroxy-3-[C-methyl-N-(2-nitrophenyl)carbonimidoyl]-1-phenylquinolin-2-one |
|---|---|
| PubChem CID | 135525034 |
| Molecular Formula | C23H17N3O4 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 4-hydroxy-3-[C-methyl-N-(2-nitrophenyl)carbonimidoyl]-1-phenylquinolin-2-one |
| SMILES | C/C(=N\c1ccccc1[N+](=O)[O-])c1c(O)c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H17N3O4/c1-15(24-18-12-6-8-14-20(18)26(29)30)21-22(27)17-11-5-7-13-19(17)25(23(21)28)16-9-3-2-4-10-16/h2-14,27H,1H3/b24-15+ |
| InChIKey | RZFRKOWBWJWZDV-BUVRLJJBSA-N |
| XLogP | 4.75 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|