C24H17N2O5- — CID 135573975
3-[N-(4-carboxy-3-hydroxyphenyl)-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate (PubChem CID 135573975) has the molecular formula C24H17N2O5- and a molecular weight of 413.41 g/mol. Its IUPAC name is 3-[N-(4-carboxy-3-hydroxyphenyl)-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate.
| Compound Name | 3-[N-(4-carboxy-3-hydroxyphenyl)-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate |
|---|---|
| PubChem CID | 135573975 |
| Molecular Formula | C24H17N2O5- |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 3-[N-(4-carboxy-3-hydroxyphenyl)-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate |
| SMILES | C/C(=N\c1ccc(C(=O)O)c(O)c1)c1c([O-])c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H18N2O5/c1-14(25-15-11-12-18(24(30)31)20(27)13-15)21-22(28)17-9-5-6-10-19(17)26(23(21)29)16-7-3-2-4-8-16/h2-13,27-28H,1H3,(H,30,31)/p-1/b25-14+ |
| InChIKey | LYYOMRJBFVWKEQ-AFUMVMLFSA-M |
| XLogP | 3.61 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|