C23H18N3O4- — CID 163125233
3-[N-[2-(dihydroxyamino)phenyl]-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate (PubChem CID 163125233) has the molecular formula C23H18N3O4- and a molecular weight of 400.41 g/mol. Its IUPAC name is 3-[N-[2-(dihydroxyamino)phenyl]-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate.
| Compound Name | 3-[N-[2-(dihydroxyamino)phenyl]-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate |
|---|---|
| PubChem CID | 163125233 |
| Molecular Formula | C23H18N3O4- |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 3-[N-[2-(dihydroxyamino)phenyl]-C-methylcarbonimidoyl]-2-oxo-1-phenylquinolin-4-olate |
| SMILES | C/C(=N\c1ccccc1N(O)O)c1c([O-])c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H19N3O4/c1-15(24-18-12-6-8-14-20(18)26(29)30)21-22(27)17-11-5-7-13-19(17)25(23(21)28)16-9-3-2-4-10-16/h2-14,27,29-30H,1H3/p-1/b24-15+ |
| InChIKey | LHZMNRBEYYTISU-BUVRLJJBSA-M |
| XLogP | 3.79 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|