C22H20N4O8 — CID 22922050
(4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)-(2,3-diacetyloxyphenyl)carbamic acid (PubChem CID 22922050) has the molecular formula C22H20N4O8 and a molecular weight of 468.42 g/mol. Its IUPAC name is (4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)-(2,3-diacetyloxyphenyl)carbamic acid.
| Compound Name | (4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)-(2,3-diacetyloxyphenyl)carbamic acid |
|---|---|
| PubChem CID | 22922050 |
| Molecular Formula | C22H20N4O8 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | (4-amino-1-methyl-2,6-dioxo-3-phenylpyrimidin-5-yl)-(2,3-diacetyloxyphenyl)carbamic acid |
| SMILES | CC(=O)Oc1cccc(N(C(=O)O)c2c(N)n(-c3ccccc3)c(=O)n(C)c2=O)c1OC(C)=O |
| InChI | InChI=1S/C22H20N4O8/c1-12(27)33-16-11-7-10-15(18(16)34-13(2)28)26(22(31)32)17-19(23)25(14-8-5-4-6-9-14)21(30)24(3)20(17)29/h4-11H,23H2,1-3H3,(H,31,32) |
| InChIKey | QPSBDQAYPWTWLW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 163.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|