C17H19Cl2N5O2 — CID 135443327
2-[(3,4-dichlorophenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one (PubChem CID 135443327) has the molecular formula C17H19Cl2N5O2 and a molecular weight of 396.28 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one.
| Compound Name | 2-[(3,4-dichlorophenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135443327 |
| Molecular Formula | C17H19Cl2N5O2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylamino]-7-(4-methoxybutyl)-1H-purin-6-one |
| SMILES | COCCCCn1cnc2nc(NCc3ccc(Cl)c(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C17H19Cl2N5O2/c1-26-7-3-2-6-24-10-21-15-14(24)16(25)23-17(22-15)20-9-11-4-5-12(18)13(19)8-11/h4-5,8,10H,2-3,6-7,9H2,1H3,(H2,20,22,23,25) |
| InChIKey | PPOIWUROMYTRRK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|