C28H33N3O9S2 — CID 135443382
butyl 2-[2-[2-[[2-hydroxy-5-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]ethyl]-5-(2-methylsulfonylphenyl)phenoxy]acetate (PubChem CID 135443382) has the molecular formula C28H33N3O9S2 and a molecular weight of 619.72 g/mol. Its IUPAC name is butyl 2-[2-[2-[[2-hydroxy-5-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]ethyl]-5-(2-methylsulfonylphenyl)phenoxy]acetate.
| Compound Name | butyl 2-[2-[2-[[2-hydroxy-5-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]ethyl]-5-(2-methylsulfonylphenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 135443382 |
| Molecular Formula | C28H33N3O9S2 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | butyl 2-[2-[2-[[2-hydroxy-5-[(Z)-N'-hydroxycarbamimidoyl]phenyl]sulfonylamino]ethyl]-5-(2-methylsulfonylphenyl)phenoxy]acetate |
| SMILES | CCCCOC(=O)COc1cc(-c2ccccc2S(C)(=O)=O)ccc1CCNS(=O)(=O)c1cc(/C(N)=N/O)ccc1O |
| InChI | InChI=1S/C28H33N3O9S2/c1-3-4-15-39-27(33)18-40-24-16-20(22-7-5-6-8-25(22)41(2,35)36)10-9-19(24)13-14-30-42(37,38)26-17-21(28(29)31-34)11-12-23(26)32/h5-12,16-17,30,32,34H,3-4,13-15,18H2,1-2H3,(H2,29,31) |
| InChIKey | PQCIYLDSCOZTFR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 194.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|