C23H20F3N3O6S — CID 135610115
2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid (PubChem CID 135610115) has the molecular formula C23H20F3N3O6S and a molecular weight of 523.49 g/mol. Its IUPAC name is 2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid.
| Compound Name | 2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 135610115 |
| Molecular Formula | C23H20F3N3O6S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | 2-[2-[2-[(5-carbamimidoyl-2-hydroxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(O)c(S(=O)(=O)NCCc2ccc(-c3cc(F)c(F)c(F)c3)cc2OCC(=O)O)c1 |
| InChI | InChI=1S/C23H20F3N3O6S/c24-16-7-15(8-17(25)22(16)26)13-2-1-12(19(9-13)35-11-21(31)32)5-6-29-36(33,34)20-10-14(23(27)28)3-4-18(20)30/h1-4,7-10,29-30H,5-6,11H2,(H3,27,28)(H,31,32) |
| InChIKey | ZLZOAVLUQQEGPR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 162.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|