C28H24BrN3O6S — CID 135446510
ethyl 4-[[5-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135446510) has the molecular formula C28H24BrN3O6S and a molecular weight of 610.49 g/mol. Its IUPAC name is ethyl 4-[[5-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | ethyl 4-[[5-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135446510 |
| Molecular Formula | C28H24BrN3O6S |
| Molecular Weight | 610.49 g/mol |
| Exact Mass | 609.06 |
| IUPAC Name | ethyl 4-[[5-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=C2/NC(=O)C(=Cc3cc(Br)ccc3OCC(=O)Nc3ccccc3OC)S2)cc1 |
| InChI | InChI=1S/C28H24BrN3O6S/c1-3-37-27(35)17-8-11-20(12-9-17)30-28-32-26(34)24(39-28)15-18-14-19(29)10-13-22(18)38-16-25(33)31-21-6-4-5-7-23(21)36-2/h4-15H,3,16H2,1-2H3,(H,31,33)(H,30,32,34) |
| InChIKey | DBZLPUVQYDYFMG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|