C17H14N4O2 — CID 135446731
N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 135446731) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135446731 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccccc1O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C17H14N4O2/c22-16-9-5-4-8-13(16)11-18-21-17(23)15-10-14(19-20-15)12-6-2-1-3-7-12/h1-11,22H,(H,19,20)(H,21,23)/b18-11+ |
| InChIKey | BDZRXAQWEHDNHX-WOJGMQOQSA-N |
| XLogP | 2.55 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|