C17H13Cl2NO3 — CID 135447037
2-[(3,5-dichlorophenyl)iminomethyl]-5-(furan-2-yl)-3-hydroxycyclohex-2-en-1-one (PubChem CID 135447037) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)iminomethyl]-5-(furan-2-yl)-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[(3,5-dichlorophenyl)iminomethyl]-5-(furan-2-yl)-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135447037 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)iminomethyl]-5-(furan-2-yl)-3-hydroxycyclohex-2-en-1-one |
| SMILES | O=C1CC(c2ccco2)CC(O)=C1/C=N/c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2NO3/c18-11-6-12(19)8-13(7-11)20-9-14-15(21)4-10(5-16(14)22)17-2-1-3-23-17/h1-3,6-10,21H,4-5H2/b20-9+ |
| InChIKey | AKFOCHFBBUHLEJ-AWQFTUOYSA-N |
| XLogP | 5.25 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|