C18H13Cl2NO2 — CID 139052395
3-[(3,5-dichlorophenyl)iminomethyl]-5-(4-methylphenyl)furan-2-ol (PubChem CID 139052395) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)iminomethyl]-5-(4-methylphenyl)furan-2-ol.
| Compound Name | 3-[(3,5-dichlorophenyl)iminomethyl]-5-(4-methylphenyl)furan-2-ol |
|---|---|
| PubChem CID | 139052395 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)iminomethyl]-5-(4-methylphenyl)furan-2-ol |
| SMILES | Cc1ccc(-c2cc(/C=N/c3cc(Cl)cc(Cl)c3)c(O)o2)cc1 |
| InChI | InChI=1S/C18H13Cl2NO2/c1-11-2-4-12(5-3-11)17-6-13(18(22)23-17)10-21-16-8-14(19)7-15(20)9-16/h2-10,22H,1H3/b21-10+ |
| InChIKey | DHTNCTLSFFUNOE-UFFVCSGVSA-N |
| XLogP | 6.02 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|