C19H13ClFNO3 — CID 1279985
5-[5-[(3-chloro-4-fluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid (PubChem CID 1279985) has the molecular formula C19H13ClFNO3 and a molecular weight of 357.77 g/mol. Its IUPAC name is 5-[5-[(3-chloro-4-fluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid.
| Compound Name | 5-[5-[(3-chloro-4-fluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 1279985 |
| Molecular Formula | C19H13ClFNO3 |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 5-[5-[(3-chloro-4-fluorophenyl)iminomethyl]furan-2-yl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(-c2ccc(/C=N/c3ccc(F)c(Cl)c3)o2)cc1C(=O)O |
| InChI | InChI=1S/C19H13ClFNO3/c1-11-2-3-12(8-15(11)19(23)24)18-7-5-14(25-18)10-22-13-4-6-17(21)16(20)9-13/h2-10H,1H3,(H,23,24)/b22-10+ |
| InChIKey | LUKFPMURQFCWPX-LSHDLFTRSA-N |
| XLogP | 5.50 |
| TPSA | 62.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|