C19H17NO3S2 — CID 135447285
ethyl 4-hydroxy-2-(4-methylphenyl)imino-5-(thiophen-2-ylmethylidene)thiophene-3-carboxylate (PubChem CID 135447285) has the molecular formula C19H17NO3S2 and a molecular weight of 371.48 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-(4-methylphenyl)imino-5-(thiophen-2-ylmethylidene)thiophene-3-carboxylate.
| Compound Name | ethyl 4-hydroxy-2-(4-methylphenyl)imino-5-(thiophen-2-ylmethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135447285 |
| Molecular Formula | C19H17NO3S2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | ethyl 4-hydroxy-2-(4-methylphenyl)imino-5-(thiophen-2-ylmethylidene)thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cccs2)S/C1=N\c1ccc(C)cc1 |
| InChI | InChI=1S/C19H17NO3S2/c1-3-23-19(22)16-17(21)15(11-14-5-4-10-24-14)25-18(16)20-13-8-6-12(2)7-9-13/h4-11,21H,3H2,1-2H3/b15-11?,20-18- |
| InChIKey | SGRJDJPGPAXSGT-SQFXOBFSSA-N |
| XLogP | 5.25 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|