C21H18ClNO3S — CID 135493061
ethyl (5Z)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(4-methylphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 135493061) has the molecular formula C21H18ClNO3S and a molecular weight of 399.90 g/mol. Its IUPAC name is ethyl (5Z)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(4-methylphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(4-methylphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135493061 |
| Molecular Formula | C21H18ClNO3S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | ethyl (5Z)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(4-methylphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2ccc(C)cc2)S/C1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H18ClNO3S/c1-3-26-21(25)18-19(24)17(11-14-9-7-13(2)8-10-14)27-20(18)23-16-6-4-5-15(22)12-16/h4-12,24H,3H2,1-2H3/b17-11-,23-20- |
| InChIKey | NQXGFFZXRVVFRA-NKHYKUCGSA-N |
| XLogP | 5.84 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|