C26H20ClNO4S — CID 135643502
ethyl (5E)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(3-phenoxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 135643502) has the molecular formula C26H20ClNO4S and a molecular weight of 477.97 g/mol. Its IUPAC name is ethyl (5E)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(3-phenoxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl (5E)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(3-phenoxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 135643502 |
| Molecular Formula | C26H20ClNO4S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | ethyl (5E)-2-(3-chlorophenyl)imino-4-hydroxy-5-[(3-phenoxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C\c2cccc(Oc3ccccc3)c2)S/C1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H20ClNO4S/c1-2-31-26(30)23-24(29)22(33-25(23)28-19-10-7-9-18(27)16-19)15-17-8-6-13-21(14-17)32-20-11-4-3-5-12-20/h3-16,29H,2H2,1H3/b22-15+,28-25- |
| InChIKey | HCYFKQYNFXRHMX-RLRMVDLFSA-N |
| XLogP | 7.33 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|