C22H21NO5S — CID 171136038
ethyl 2-(4-ethoxyphenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate (PubChem CID 171136038) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is ethyl 2-(4-ethoxyphenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate.
| Compound Name | ethyl 2-(4-ethoxyphenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 171136038 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | ethyl 2-(4-ethoxyphenyl)imino-4-hydroxy-5-[(3-hydroxyphenyl)methylidene]thiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C(=Cc2cccc(O)c2)S/C1=N\c1ccc(OCC)cc1 |
| InChI | InChI=1S/C22H21NO5S/c1-3-27-17-10-8-15(9-11-17)23-21-19(22(26)28-4-2)20(25)18(29-21)13-14-6-5-7-16(24)12-14/h5-13,24-25H,3-4H2,1-2H3/b18-13?,23-21- |
| InChIKey | JTNGITLHKTYHIS-DGBSIKRBSA-N |
| XLogP | 4.98 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|