C21H19NO4S — CID 135940091
methyl (5E)-5-benzylidene-2-(4-ethoxyphenyl)imino-4-hydroxythiophene-3-carboxylate (PubChem CID 135940091) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is methyl (5E)-5-benzylidene-2-(4-ethoxyphenyl)imino-4-hydroxythiophene-3-carboxylate.
| Compound Name | methyl (5E)-5-benzylidene-2-(4-ethoxyphenyl)imino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 135940091 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl (5E)-5-benzylidene-2-(4-ethoxyphenyl)imino-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOc1ccc(/N=C2\S/C(=C/c3ccccc3)C(O)=C2C(=O)OC)cc1 |
| InChI | InChI=1S/C21H19NO4S/c1-3-26-16-11-9-15(10-12-16)22-20-18(21(24)25-2)19(23)17(27-20)13-14-7-5-4-6-8-14/h4-13,23H,3H2,1-2H3/b17-13+,22-20- |
| InChIKey | SDRBSMZJZDFQEA-CWOOXZEWSA-N |
| XLogP | 4.89 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|