C20H17NO4S — CID 135533511
methyl 4-hydroxy-5-[(4-methoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate (PubChem CID 135533511) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is methyl 4-hydroxy-5-[(4-methoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate.
| Compound Name | methyl 4-hydroxy-5-[(4-methoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135533511 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | methyl 4-hydroxy-5-[(4-methoxyphenyl)methylidene]-2-phenyliminothiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2ccc(OC)cc2)S/C1=N\c1ccccc1 |
| InChI | InChI=1S/C20H17NO4S/c1-24-15-10-8-13(9-11-15)12-16-18(22)17(20(23)25-2)19(26-16)21-14-6-4-3-5-7-14/h3-12,22H,1-2H3/b16-12?,21-19- |
| InChIKey | YGXABGZIMOWPOB-OIDXGIRASA-N |
| XLogP | 4.50 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|