C29H20N4O2 — CID 135448429
3-[4-[[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]methyl]phenyl]imino-1H-indol-2-one (PubChem CID 135448429) has the molecular formula C29H20N4O2 and a molecular weight of 456.51 g/mol. Its IUPAC name is 3-[4-[[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]methyl]phenyl]imino-1H-indol-2-one.
| Compound Name | 3-[4-[[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]methyl]phenyl]imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135448429 |
| Molecular Formula | C29H20N4O2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[4-[[4-[(2-oxo-1H-indol-3-ylidene)amino]phenyl]methyl]phenyl]imino-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=N/c1ccc(Cc2ccc(/N=C3\C(=O)Nc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C29H20N4O2/c34-28-26(22-5-1-3-7-24(22)32-28)30-20-13-9-18(10-14-20)17-19-11-15-21(16-12-19)31-27-23-6-2-4-8-25(23)33-29(27)35/h1-16H,17H2,(H,30,32,34)(H,31,33,35) |
| InChIKey | ORDQRCSDFGGQRM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|