C17H18N6 — CID 135450786
5-pentyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135450786) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-pentyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine.
| Compound Name | 5-pentyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
|---|---|
| PubChem CID | 135450786 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 5-pentyl-8-phenyl-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | CCCCCc1nc2nc[nH]c2c2nc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C17H18N6/c1-2-3-5-10-13-20-16-14(18-11-19-16)17-21-15(22-23(13)17)12-8-6-4-7-9-12/h4,6-9,11H,2-3,5,10H2,1H3,(H,18,19) |
| InChIKey | CFXLUAWKGPSLGN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|