C13H14N4O — CID 135455303
2,4-dimethyl-5-[(Z)-(phenylhydrazinylidene)methyl]-1H-pyrimidin-6-one (PubChem CID 135455303) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 2,4-dimethyl-5-[(Z)-(phenylhydrazinylidene)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2,4-dimethyl-5-[(Z)-(phenylhydrazinylidene)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135455303 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2,4-dimethyl-5-[(Z)-(phenylhydrazinylidene)methyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(C)c(/C=N\Nc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H14N4O/c1-9-12(13(18)16-10(2)15-9)8-14-17-11-6-4-3-5-7-11/h3-8,17H,1-2H3,(H,15,16,18)/b14-8- |
| InChIKey | WRMLQFGXLRNYAT-ZSOIEALJSA-N |
| XLogP | 1.83 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|