C41H25FN8O2 — CID 135456157
5-(4-fluoro-3-nitrophenyl)-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin (PubChem CID 135456157) has the molecular formula C41H25FN8O2 and a molecular weight of 680.70 g/mol. Its IUPAC name is 5-(4-fluoro-3-nitrophenyl)-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin.
| Compound Name | 5-(4-fluoro-3-nitrophenyl)-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135456157 |
| Molecular Formula | C41H25FN8O2 |
| Molecular Weight | 680.70 g/mol |
| Exact Mass | 680.21 |
| IUPAC Name | 5-(4-fluoro-3-nitrophenyl)-10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin |
| SMILES | O=[N+]([O-])c1cc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccncc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)ccc1F |
| InChI | InChI=1S/C41H25FN8O2/c42-28-2-1-27(23-37(28)50(51)52)41-35-9-7-33(48-35)39(25-13-19-44-20-14-25)31-5-3-29(46-31)38(24-11-17-43-18-12-24)30-4-6-32(47-30)40(26-15-21-45-22-16-26)34-8-10-36(41)49-34/h1-23,46,49H/b38-29-,38-30-,39-31-,39-33-,40-32-,40-34-,41-35-,41-36- |
| InChIKey | BLPJSZYZCGDBJJ-ALKJGGIUSA-N |
| XLogP | 9.56 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.70 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|