C17H11N3O2 — CID 135456736
10-benzoyl-3H-pyrimido[5,4-a]indolizin-4-one (PubChem CID 135456736) has the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. Its IUPAC name is 10-benzoyl-3H-pyrimido[5,4-a]indolizin-4-one.
| Compound Name | 10-benzoyl-3H-pyrimido[5,4-a]indolizin-4-one |
|---|---|
| PubChem CID | 135456736 |
| Molecular Formula | C17H11N3O2 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 10-benzoyl-3H-pyrimido[5,4-a]indolizin-4-one |
| SMILES | O=C(c1ccccc1)c1c2nc[nH]c(=O)c2c2ccccn12 |
| InChI | InChI=1S/C17H11N3O2/c21-16(11-6-2-1-3-7-11)15-14-13(17(22)19-10-18-14)12-8-4-5-9-20(12)15/h1-10H,(H,18,19,22) |
| InChIKey | YFHAIDLPXXOOLF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |