C13H14N2O3 — CID 135456817
1-hydroxy-4-methyl-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-2,11-dione (PubChem CID 135456817) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-hydroxy-4-methyl-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-2,11-dione.
| Compound Name | 1-hydroxy-4-methyl-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-2,11-dione |
|---|---|
| PubChem CID | 135456817 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-hydroxy-4-methyl-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-2,11-dione |
| SMILES | CC1=CC(=O)C(O)=C2C(=O)N3CCCC3CN=C12 |
| InChI | InChI=1S/C13H14N2O3/c1-7-5-9(16)12(17)10-11(7)14-6-8-3-2-4-15(8)13(10)18/h5,8,17H,2-4,6H2,1H3 |
| InChIKey | VZQPFVLTHXJGHL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|