C22H18F3N3 — CID 135458217
(4S,5R)-4,5-bis(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]imidazolidin-2-imine (PubChem CID 135458217) has the molecular formula C22H18F3N3 and a molecular weight of 381.40 g/mol. Its IUPAC name is (4S,5R)-4,5-bis(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]imidazolidin-2-imine.
| Compound Name | (4S,5R)-4,5-bis(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]imidazolidin-2-imine |
|---|---|
| PubChem CID | 135458217 |
| Molecular Formula | C22H18F3N3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (4S,5R)-4,5-bis(3-fluorophenyl)-N-[(3-fluorophenyl)methyl]imidazolidin-2-imine |
| SMILES | Fc1cccc(C/N=C2/N[C@H](c3cccc(F)c3)[C@H](c3cccc(F)c3)N2)c1 |
| InChI | InChI=1S/C22H18F3N3/c23-17-7-1-4-14(10-17)13-26-22-27-20(15-5-2-8-18(24)11-15)21(28-22)16-6-3-9-19(25)12-16/h1-12,20-21H,13H2,(H2,26,27,28)/t20-,21+ |
| InChIKey | WINIQPJCGMYACE-OYRHEFFESA-N |
| XLogP | 4.64 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|