C8H12N6O — CID 135459390
5-[(E)-[methyl(prop-2-enyl)amino]diazenyl]-1H-pyrazole-4-carboxamide (PubChem CID 135459390) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-[(E)-[methyl(prop-2-enyl)amino]diazenyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(E)-[methyl(prop-2-enyl)amino]diazenyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 135459390 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5-[(E)-[methyl(prop-2-enyl)amino]diazenyl]-1H-pyrazole-4-carboxamide |
| SMILES | C=CCN(C)/N=N/c1[nH]ncc1C(N)=O |
| InChI | InChI=1S/C8H12N6O/c1-3-4-14(2)13-12-8-6(7(9)15)5-10-11-8/h3,5H,1,4H2,2H3,(H2,9,15)(H,10,11)/b13-12+ |
| InChIKey | OEZWEQYFSAITSH-OUKQBFOZSA-N |
| XLogP | 0.63 |
| TPSA | 99.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|