C6H10N4O — CID 13282254
5-amino-N,N-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 13282254) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-amino-N,N-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | 5-amino-N,N-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 13282254 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 5-amino-N,N-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | CN(C)C(=O)c1cn[nH]c1N |
| InChI | InChI=1S/C6H10N4O/c1-10(2)6(11)4-3-8-9-5(4)7/h3H,1-2H3,(H3,7,8,9) |
| InChIKey | HKKLWOKERSXLDX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |