C5H6N6O — CID 135905161
6-hydrazinyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135905161) has the molecular formula C5H6N6O and a molecular weight of 166.14 g/mol. Its IUPAC name is 6-hydrazinyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-hydrazinyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135905161 |
| Molecular Formula | C5H6N6O |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 6-hydrazinyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | NNc1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C5H6N6O/c6-10-5-8-3-2(1-7-11-3)4(12)9-5/h1H,6H2,(H3,7,8,9,10,11,12) |
| InChIKey | LEFRWEFKNQEIDR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|