C5H5N5O — CID 135403386
6-amino-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135403386) has the molecular formula C5H5N5O and a molecular weight of 151.13 g/mol. Its IUPAC name is 6-amino-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-amino-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135403386 |
| Molecular Formula | C5H5N5O |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 6-amino-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | Nc1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5O/c6-5-8-3-2(1-7-10-3)4(11)9-5/h1H,(H4,6,7,8,9,10,11) |
| InChIKey | BZUZJVLPAKJIBP-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |