C9H12N4OS — CID 135517173
6-butylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135517173) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 6-butylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-butylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135517173 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 6-butylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCCCSc1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C9H12N4OS/c1-2-3-4-15-9-11-7-6(5-10-13-7)8(14)12-9/h5H,2-4H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | KDXKXYOWAMEDIA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|