C8H8N4OS — CID 135472830
6-prop-2-enylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135472830) has the molecular formula C8H8N4OS and a molecular weight of 208.25 g/mol. Its IUPAC name is 6-prop-2-enylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-prop-2-enylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135472830 |
| Molecular Formula | C8H8N4OS |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 6-prop-2-enylsulfanyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | C=CCSc1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C8H8N4OS/c1-2-3-14-8-10-6-5(4-9-12-6)7(13)11-8/h2,4H,1,3H2,(H2,9,10,11,12,13) |
| InChIKey | XVMNMLNJNSMBOL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|