C19H17ClN2O2S — CID 135459452
2-benzylsulfanyl-4-(4-chlorophenyl)-5-(2-hydroxyethyl)-1H-pyrimidin-6-one (PubChem CID 135459452) has the molecular formula C19H17ClN2O2S and a molecular weight of 372.88 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-(4-chlorophenyl)-5-(2-hydroxyethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-benzylsulfanyl-4-(4-chlorophenyl)-5-(2-hydroxyethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135459452 |
| Molecular Formula | C19H17ClN2O2S |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 2-benzylsulfanyl-4-(4-chlorophenyl)-5-(2-hydroxyethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(SCc2ccccc2)nc(-c2ccc(Cl)cc2)c1CCO |
| InChI | InChI=1S/C19H17ClN2O2S/c20-15-8-6-14(7-9-15)17-16(10-11-23)18(24)22-19(21-17)25-12-13-4-2-1-3-5-13/h1-9,23H,10-12H2,(H,21,22,24) |
| InChIKey | WLNFPDLBVDPYJU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |